For research use only. Not for therapeutic Use.
Cophylline (CAT: M129563) is a methylated xanthine alkaloid closely related to caffeine, found in certain plants like Coffea species. It exhibits stimulant properties and functions as a bronchodilator, similar to other xanthines like theophylline. Cophylline has been studied for its potential in treating respiratory diseases like asthma, due to its ability to relax smooth muscles in the airways. Additionally, it may have mild diuretic effects and influence central nervous system activity. However, more research is required to fully understand its pharmacological potential.
| CAS Number | 142741-24-0 |
| Molecular Formula | C44H50N4O10 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | dimethyl 14,25-diethyl-24,33-dihydroxy-31,32-dimethoxy-12,22-dioxa-1,9,18,29-tetrazadodecacyclo[23.13.1.16,9.02,23.03,21.05,19.06,17.011,13.028,36.030,35.036,39.014,40]tetraconta-3,5(19),16,20,27,30,32,34-octaene-16,27-dicarboxylate |
| InChI | 1S/C44H50N4O10/c1-7-41-16-20(37(51)55-5)34-44(23-14-25(49)30(53-3)31(54-4)28(23)46-34)10-12-48(40(41)44)29-19-13-22-24(15-26(19)57-32(29)35(41)50)45-33-21(38(52)56-6)17-42(8-2)36-27(58-36)18-47-11-9-43(22,33)39(42)47/h13-15,27,29,32,35-36,39-40,45-46,49-50H,7-12,16-18H2,1-6H3 |
| InChIKey | QZRIMAMDGWAHPQ-UHFFFAOYSA-N |
| SMILES | CCC12CC(=C3C4(C1N(CC4)C5C(C2O)OC6=CC7=C(C=C56)C89CCN1C8C(CC(=C9N7)C(=O)OC)(C2C(C1)O2)CC)C1=CC(=C(C(=C1N3)OC)OC)O)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |