For research use only. Not for therapeutic Use.
Colutehydroquinone（Cat No.:I044847）is a naturally occurring hydroquinone derivative isolated from plants in the Colutea genus, known for their use in traditional medicine. Structurally, it features a hydroquinone (benzene-1,4-diol) core with additional substituents that enhance its bioactivity. Colutehydroquinone exhibits antioxidant and antimicrobial properties, primarily through its ability to scavenge reactive oxygen species and disrupt microbial cell processes. Its redox-active nature allows it to interact with cellular components involved in oxidative stress. Due to these properties, colutehydroquinone is of interest in natural product research focused on developing therapeutic agents for inflammation and infection-related conditions.
| CAS Number | 181311-16-0 |
| Synonyms | 2,3-dimethoxy-5-[(3R)-7-methoxy-3,4-dihydro-2H-chromen-3-yl]benzene-1,4-diol |
| Molecular Formula | C18H20O6 |
| Purity | ≥95% |
| IUPAC Name | 2,3-dimethoxy-5-[(3R)-7-methoxy-3,4-dihydro-2H-chromen-3-yl]benzene-1,4-diol |
| InChI | InChI=1S/C18H20O6/c1-21-12-5-4-10-6-11(9-24-15(10)7-12)13-8-14(19)17(22-2)18(23-3)16(13)20/h4-5,7-8,11,19-20H,6,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | RRVWIPPRKMQDAO-NSHDSACASA-N |
| SMILES | COC1=CC2=C(C[C@@H](CO2)C3=CC(=C(C(=C3O)OC)OC)O)C=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
