For research use only. Not for therapeutic Use.
Columbamine chloride(CAT: I040432) is a quaternary ammonium salt form of columbamine, a naturally occurring isoquinoline alkaloid commonly found in Berberis and Coptis species. Structurally related to berberine, columbamine exhibits a range of bioactivities including antimicrobial, anti-inflammatory, and anticancer effects. As a chloride salt, it offers enhanced solubility and stability in aqueous solutions, making it suitable for pharmacological research and biochemical assays. Columbamine chloride is particularly valuable for studies exploring alkaloid-based modulation of cellular signaling pathways, including AMPK and MAPK. It is a promising compound for natural product screening, drug discovery, and the development of plant-derived therapeutic agents.
| CAS Number | 1916-10-5 |
| Synonyms | 3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol;chloride |
| Molecular Formula | C20H20ClNO4 |
| Purity | ≥95% |
| IUPAC Name | 3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol;chloride |
| InChI | InChI=1S/C20H19NO4.ClH/c1-23-18-5-4-12-8-16-14-10-17(22)19(24-2)9-13(14)6-7-21(16)11-15(12)20(18)25-3;/h4-5,8-11H,6-7H2,1-3H3;1H |
| InChIKey | KDUDGYVKQSKHQG-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)O)OC.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
