For research use only. Not for therapeutic Use.
CMP-5（Cat No.:I015550）is a synthetic small-molecule inhibitor explored for its role in modulating inflammatory and fibrotic pathways. Preclinical research indicates that CMP-5 targets signaling mechanisms linked to tissue remodeling, immune activation, and pathological fibrosis, making it relevant in models of pulmonary and hepatic disease. By attenuating pro-inflammatory cytokine release and extracellular matrix deposition, CMP-5 demonstrates potential as a therapeutic lead for chronic inflammatory disorders. Though still in early investigation, it serves as a valuable research tool in pharmacology and disease biology for understanding fibrotic progression and therapeutic intervention.
| CAS Number | 880813-42-3 |
| Synonyms | 1-(9-ethylcarbazol-3-yl)-N-(pyridin-2-ylmethyl)methanamine |
| Molecular Formula | C21H21N3 |
| Purity | ≥95% |
| IUPAC Name | 1-(9-ethylcarbazol-3-yl)-N-(pyridin-2-ylmethyl)methanamine |
| InChI | InChI=1S/C21H21N3/c1-2-24-20-9-4-3-8-18(20)19-13-16(10-11-21(19)24)14-22-15-17-7-5-6-12-23-17/h3-13,22H,2,14-15H2,1H3 |
| InChIKey | YPJMOVVQKBFRNH-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)CNCC3=CC=CC=N3)C4=CC=CC=C41 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
