For research use only. Not for therapeutic Use.
Clozapine(Cat No.:A000188)is an atypical antipsychotic medication with the molecular formula C18H19ClN4, primarily used to treat treatment-resistant schizophrenia and to reduce the risk of recurrent suicidal behavior in schizophrenia or schizoaffective disorder. It acts on multiple neurotransmitter receptors, including dopamine D2, serotonin 5-HT2A, and others, helping to manage both positive and negative symptoms of psychosis. Clozapine is known for its efficacy in difficult cases but requires regular blood monitoring due to the risk of agranulocytosis. It is administered orally and is considered a gold standard for refractory psychiatric conditions.
| CAS Number | 5786-21-0 |
| Synonyms | 5786-21-0; Leponex; Clozapin; CLOZARIL; Fazaclo |
| Molecular Formula | C18H19ClN4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >14.6mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 3-chloro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine |
| InChI | InChI=1S/C18H19ClN4/c1-22-8-10-23(11-9-22)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)21-18/h2-7,12,20H,8-11H2,1H3 |
| InChIKey | QZUDBNBUXVUHMW-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(C=CC(=C3)Cl)NC4=CC=CC=C42 |
| Reference | 1: Kaplan AM, Pitts WB, Ahmed I. An Unexpected Circumstance: Acute Dystonic 2: Rajagopal VM, Rajkumar AP, Jacob KS, Jacob M. Gene-gene interaction between 3: Suresh Kumar PN, Gopalakrishnan A. Clozapine-associated Pisa syndrome: A rare 4: Kim SH, Park S, Yu HS, Ko KH, Park HG, Kim YS. The antipsychotic agent 5: Geers LM, Cohen D, Wehkamp LM, van Hateren K, Koster RA, Fedorenko OY, Semke <br> 7: Joy G, Whiskey E, Bolstridge M, Porras-Segovia A, McDonagh TA, Plymen CM, 8: Liu Z, Cui C, Xu P, Dang R, Cai H, Liao D, Yang M, Feng Q, Yan X, Jiang P. 9: Misawa F, Suzuki T, Fujii Y. Effect of Clozapine vs Other Second-Generation 10: Todorović N, Filipović D. The antidepressant- and anxiolytic-like effects of |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |