For research use only. Not for therapeutic Use.
Clopamide（Cat No.:R050632）is a thiazide-like diuretic used to treat hypertension and edema associated with heart failure, liver cirrhosis, or renal disorders. It works by inhibiting sodium and chloride reabsorption in the distal convoluted tubules of the kidneys, promoting diuresis and reducing blood volume. Unlike classical thiazides, clopamide has a distinct chemical structure but similar pharmacological effects. It may also exhibit mild antihypertensive effects independent of diuresis. Clopamide is generally well tolerated but can cause electrolyte imbalances, such as hypokalemia. It is used therapeutically in various cardiovascular and renal conditions.
| CAS Number | 636-54-4 |
| Synonyms | 4-chloro-N-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-3-sulfamoylbenzamide |
| Molecular Formula | C14H20ClN3O3S |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-N-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-3-sulfamoylbenzamide |
| InChI | InChI=1S/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21)/t9-,10+ |
| InChIKey | LBXHRAWDUMTPSE-AOOOYVTPSA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
