For research use only. Not for therapeutic Use.
Cl-PEG6-acid（Cat No.:I044632）is a bifunctional polyethylene glycol (PEG) linker featuring a terminal chloroalkyl group and a carboxylic acid, connected via a six-unit PEG spacer. The chloro group serves as a reactive handle for nucleophilic substitution with amines or thiols, enabling covalent attachment to various biomolecules or surfaces. The carboxylic acid allows further derivatization through amide bond formation using carbodiimide chemistry. The PEG6 segment enhances hydrophilicity, flexibility, and biocompatibility. Cl-PEG6-acid is widely used in bioconjugation, surface modification, and drug delivery system development in biomedical and material science research.
| CAS Number | 2365309-92-6 |
| Synonyms | 2-[2-[2-[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| Molecular Formula | C14H27ClO8 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChI | InChI=1S/C14H27ClO8/c15-1-2-18-3-4-19-5-6-20-7-8-21-9-10-22-11-12-23-13-14(16)17/h1-13H2,(H,16,17) |
| InChIKey | CFSDNFNBCGLKFQ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCC(=O)O)OCCOCCOCCCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
