For research use only. Not for therapeutic Use.
Cl-PEG2-acid（Cat No.:I045043）is a bifunctional polyethylene glycol (PEG) linker consisting of two ethylene glycol units terminated with a chloride (Cl) reactive group on one end and a carboxylic acid (–COOH) on the other. The chloride moiety enables nucleophilic substitution reactions, while the carboxylic acid allows coupling to amines via amide bond formation. Cl-PEG2-acid is commonly used in bioconjugation, drug delivery, and linker chemistry, particularly in the design of antibody-drug conjugates (ADCs) and PEGylated therapeutics. Its short PEG spacer imparts hydrophilicity, flexibility, and improved solubility to biomolecular constructs.
| CAS Number | 170304-76-4 |
| Synonyms | 2-[2-(2-chloroethoxy)ethoxy]acetic acid |
| Molecular Formula | C6H11ClO4 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-(2-chloroethoxy)ethoxy]acetic acid |
| InChI | InChI=1S/C6H11ClO4/c7-1-2-10-3-4-11-5-6(8)9/h1-5H2,(H,8,9) |
| InChIKey | WNFWETCQRCCYKU-UHFFFAOYSA-N |
| SMILES | C(COCC(=O)O)OCCCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
