For research use only. Not for therapeutic Use.
Citroxin(CAT: M068733) is a compound formed from the combination of 8-hydroxyquinoline and citric acid. 8-Hydroxyquinoline, also known as oxine, is a chelating agent with the ability to form complexes with metal ions, making it useful in various chemical and biological applications. When combined with citric acid, the citrate component likely enhances the solubility of the compound and potentially modifies its metal-chelating properties. 8-Hydroxyquinoline citrate is commonly used in industrial and pharmaceutical contexts, particularly as a preservative, disinfectant, or antifungal agent. It may also have applications in metal ion detection, water treatment, and agriculture due to its ability to bind to metals and inhibit the growth of microorganisms.
| CAS Number | 134-30-5 |
| Synonyms | 8-Hydroxyquinoline citrate; Quinolin-8-ol 2-hydroxypropane-1,2,3-tricarboxylate |
| Molecular Formula | C15H15NO8 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;quinolin-8-ol |
| InChI | InChI=1S/C9H7NO.C6H8O7/c11-8-5-1-3-7-4-2-6-10-9(7)8;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-6,11H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | GTOQWWQKBBZILU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)N=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |