For research use only. Not for therapeutic Use.
Citronellol (Cat No.: M070957) is a naturally occurring acyclic monoterpenoid alcohol with a pleasant, floral, rose-like aroma. Found in essential oils of plants such as citronella, rose, and geranium, it appears as a colorless to pale yellow liquid. Citronellol is widely used in perfumery, cosmetics, and personal care products for its fragrance. It also serves as an intermediate in the synthesis of insect repellents, flavors, and pharmaceuticals. Its mild antimicrobial and anti-inflammatory properties further enhance its value in cosmetic and therapeutic formulations.
| CAS Number | 106-22-9 |
| Molecular Formula | C10H20O |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| Storage | -20°C |
| IUPAC Name | 3,7-dimethyloct-6-en-1-ol |
| InChI | InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h5,10-11H,4,6-8H2,1-3H3 |
| InChIKey | QMVPMAAFGQKVCJ-UHFFFAOYSA-N |
| SMILES | CC(CCC=C(C)C)CCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
