For research use only. Not for therapeutic Use.
Citalopram（Cat No.:I044120）is a selective serotonin reuptake inhibitor (SSRI) commonly prescribed to treat depression and anxiety disorders. It works by increasing serotonin levels in the brain, enhancing mood regulation and emotional stability. Citalopram is known for its high selectivity for the serotonin transporter, resulting in fewer side effects compared to older antidepressants. It is also used off-label for conditions such as obsessive-compulsive disorder (OCD) and panic disorder. With a favorable safety profile and minimal drug interactions, citalopram remains a widely used and well-tolerated option in psychiatric and primary care settings.
| CAS Number | 59729-33-8 |
| Synonyms | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
| Molecular Formula | C20H21FN2O |
| Purity | ≥95% |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
| InChI | InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3 |
| InChIKey | WSEQXVZVJXJVFP-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
