Home
>
Chemical Reagents>Organic Building Blocks> cis-Ethyl 3-aminocyclobutanecarboxylate hydrochloride
For research use only. Not for therapeutic Use.
cis-Ethyl 3-aminocyclobutanecarboxylate hydrochloride(Cat No.:L006677), is a chemical compound with a unique molecular structure. It contains a cyclobutane ring, an ethyl group, an amino group, and a carboxylate group, with an additional hydrochloride ion. This compound’s intricate structure gives it distinctive properties, making it valuable in medicinal chemistry. It is likely used in research and drug development, where its specific structure could be crucial for designing molecules with biological activity. Compounds like this often serve as building blocks in the synthesis of complex pharmaceuticals, showcasing their significance in the creation of innovative drugs and therapeutic agents.
CAS Number | 957793-36-1 |
Molecular Formula | C7H14ClNO2 |
Purity | ≥95% |
IUPAC Name | ethyl 3-aminocyclobutane-1-carboxylate;hydrochloride |
InChI | InChI=1S/C7H13NO2.ClH/c1-2-10-7(9)5-3-6(8)4-5;/h5-6H,2-4,8H2,1H3;1H |
InChIKey | JEJWYGQWKNHONY-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CC(C1)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |