For research use only. Not for therapeutic Use.
CIQ (Cat No.: I003711) is a chemical compound known for its role as a selective modulator of NR2C- and NR2D-containing NMDA (N-methyl-D-aspartate) receptors in the central nervous system. It acts as a positive allosteric modulator, enhancing NMDA receptor function specifically at subunits associated with certain neuronal populations. This selectivity makes CIQ valuable in neuroscience research, particularly in studying synaptic plasticity, learning, and neurodegeneration. Its use is primarily experimental, aiding in the understanding of glutamatergic signaling pathways and potential therapeutic targeting.
| CAS Number | 486427-17-2 |
| Synonyms | (3-chlorophenyl)-[6,7-dimethoxy-1-[(4-methoxyphenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| Molecular Formula | C26H26ClNO5 |
| Purity | ≥95% |
| IUPAC Name | (3-chlorophenyl)-[6,7-dimethoxy-1-[(4-methoxyphenoxy)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| InChI | InChI=1S/C26H26ClNO5/c1-30-20-7-9-21(10-8-20)33-16-23-22-15-25(32-3)24(31-2)14-17(22)11-12-28(23)26(29)18-5-4-6-19(27)13-18/h4-10,13-15,23H,11-12,16H2,1-3H3 |
| InChIKey | VYMILMYEENZHAR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OCC2C3=CC(=C(C=C3CCN2C(=O)C4=CC(=CC=C4)Cl)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
