For research use only. Not for therapeutic Use.
Cinacalcet Metabolite M4(CAT: M010464) is a primary oxidative metabolite of Cinacalcet, a calcimimetic agent that allosterically activates the calcium-sensing receptor (CaSR). While Cinacalcet is clinically used to lower parathyroid hormone (PTH) levels in secondary hyperparathyroidism, parathyroid carcinoma, and primary hyperparathyroidism, its metabolites contribute to its overall pharmacokinetic and pharmacodynamic profile. Metabolite M4 arises through hepatic metabolism, retaining the structural framework necessary for studying CaSR interactions, drug disposition, and clearance. As a research tool, Cinacalcet Metabolite M4 is valuable in metabolism, pharmacology, and drug safety studies, providing insights into biotransformation pathways, therapeutic efficacy, and potential off-target effects of calcimimetic therapy.
| CAS Number | 104774-87-0 |
| Synonyms | 3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| Molecular Formula | C10H12F3N |
| Purity | ≥95% |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| InChI | InChI=1S/C10H12F3N/c11-10(12,13)9-5-1-3-8(7-9)4-2-6-14/h1,3,5,7H,2,4,6,14H2 |
| InChIKey | JMTLMFBJIQWJPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
