For research use only. Not for therapeutic Use.
Cimicifugoside H-2(Cat No.:M034793)is a bioactive triterpene glycoside extracted from the roots of Cimicifuga species, commonly known as black cohosh. This compound is renowned for its medicinal properties, particularly in traditional medicine for treating menopausal symptoms, inflammation, and hormonal imbalances. Its high purity and potent biological activity make it a valuable subject in pharmacological research, aiming to elucidate its therapeutic mechanisms and potential health benefits. Cimicifugoside H-2 is essential for developing natural health products and advancing the understanding of plant-based treatments in modern medicine.
| CAS Number | 161097-77-4 |
| Molecular Formula | C35H54O10 |
| Purity | ≥95% |
| Target | Plants |
| Storage | Store at RT |
| IUPAC Name | (1S,3R,6S,8R,12R,15R,16R,18S)-15-[(2R,5R)-5,6-dihydroxy-6-methyl-4-oxoheptan-2-yl]-18-hydroxy-7,7,12,16-tetramethyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-en-14-one |
| InChI | InChI=1S/C35H54O10/c1-17(12-18(36)28(42)31(4,5)43)25-19(37)13-32(6)22-9-8-21-30(2,3)24(45-29-27(41)26(40)20(38)15-44-29)10-11-34(21)16-35(22,34)23(39)14-33(25,32)7/h9,17,20-21,23-29,38-43H,8,10-16H2,1-7H3/t17-,20-,21+,23+,24+,25+,26+,27-,28+,29+,32+,33-,34-,35+/m1/s1 |
| InChIKey | SUNYLGIAMKNXMN-GLWILYKISA-N |
| SMILES | CC(CC(=O)C(C(C)(C)O)O)C1C(=O)CC2(C1(CC(C34C2=CCC5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)O)O)O)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |