For research use only. Not for therapeutic Use.
CIDD-0149897(CAT: I040611) is a novel small-molecule antifungal agent developed to combat resistant strains of Candida auris, an emerging multidrug-resistant fungal pathogen. It exhibits strong fungicidal activity by targeting unique components of fungal cell biology, showing low toxicity to mammalian cells and potent efficacy in preclinical models. CIDD-0149897 is particularly valuable for studying alternative antifungal mechanisms and resistance evasion strategies. Its promising pharmacological profile makes it an ideal candidate for exploratory research in mycology, infectious disease modeling, and antifungal drug development.
| CAS Number | 2862784-20-9 |
| Synonyms | (2Z)-6-(3-fluoro-4-hydroxyphenyl)-2-hydroxyimino-3H-inden-1-one |
| Molecular Formula | C15H10FNO3 |
| Purity | ≥95% |
| IUPAC Name | (2Z)-6-(3-fluoro-4-hydroxyphenyl)-2-hydroxyimino-3H-inden-1-one |
| InChI | InChI=1S/C15H10FNO3/c16-12-6-9(3-4-14(12)18)8-1-2-10-7-13(17-20)15(19)11(10)5-8/h1-6,18,20H,7H2/b17-13- |
| InChIKey | XIWQAWUOXXYWMB-LGMDPLHJSA-N |
| SMILES | C1C2=C(C=C(C=C2)C3=CC(=C(C=C3)O)F)C(=O)C1=NO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
