For research use only. Not for therapeutic Use.
CID-797718(Cat No.:I003361)is a small molecule compound studied for its potential therapeutic applications, particularly in cancer treatment. It acts as an inhibitor of specific molecular targets involved in cell signaling pathways that regulate cancer cell growth, survival, and metastasis. CID-797718 has shown promise in preclinical studies by reducing tumor cell proliferation and enhancing the effects of other cancer therapies. It may work by modulating key proteins or enzymes that are dysregulated in cancer cells. Ongoing research is focused on understanding its mechanisms of action, safety, and efficacy in clinical trials for cancer treatment.
| CAS Number | 370586-05-3 |
| Molecular Formula | C12H11NO3 |
| Purity | ≥95% |
| Solubility | DMSO: ≥ 49 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | 9-hydroxy-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one |
| InChI | InChI=1S/C12H11NO3/c14-7-3-4-10-9(6-7)8-2-1-5-13-11(8)12(15)16-10/h3-4,6,13-14H,1-2,5H2 |
| InChIKey | VDZXTSOINJESSP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)OC3=C2C=C(C=C3)O)NC1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |