For research use only. Not for therapeutic Use.
Ciclopirox ethanolamine(Cat No.:A000713)is a topical antifungal medication used to treat a variety of fungal infections, including athlete’s foot, ringworm, and seborrheic dermatitis. It works by disrupting the synthesis of fungal cell membranes, leading to cell death. Ciclopirox ethanolamine is also effective against certain bacterial infections, providing a broad-spectrum approach to skin treatment. Available in various formulations such as creams, gels, and shampoos, it is applied directly to the affected area. It is well-tolerated with minimal side effects, primarily localized skin irritation, making it a reliable option for treating fungal skin infections.
| CAS Number | 41621-49-2 |
| Synonyms | Ciclopirox ethanolamine; ciclopiroxolamine; Ciclobirox Olamine |
| Molecular Formula | C12H17NO2.C2H7NO |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | 2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one |
| InChI | InChI=1S/C12H17NO2.C2H7NO/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10,15H,2-6H2,1H3;4H,1-3H2 |
| InChIKey | MBRHNTMUYWQHMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C(=C1)C2CCCCC2)O.C(CO)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |