For research use only. Not for therapeutic Use.
Cichoriin（Cat No.:I044807）is a naturally occurring coumarin glycoside, specifically a 6,7-dihydroxycoumarin-7-glucoside, found in plants like Cichorium intybus (chicory) and other members of the Asteraceae family. It exhibits various pharmacological properties, including antioxidant, anti-inflammatory, and hepatoprotective effects. Cichoriin has been studied for its ability to scavenge free radicals, support liver function, and modulate inflammatory pathways. Its glycosylated structure enhances water solubility and bioavailability, making it suitable for therapeutic applications. Due to its natural origin and beneficial bioactivity, cichoriin is being explored for use in functional foods, herbal remedies, and pharmaceutical development.
| CAS Number | 531-58-8 |
| Synonyms | 6-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| Molecular Formula | C15H16O9 |
| Purity | ≥95% |
| IUPAC Name | 6-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| InChI | InChI=1S/C15H16O9/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-4-8-6(3-7(9)17)1-2-11(18)22-8/h1-4,10,12-17,19-21H,5H2/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | WNBCMONIPIJTSB-TVKJYDDYSA-N |
| SMILES | C1=CC(=O)OC2=CC(=C(C=C21)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
