For research use only. Not for therapeutic Use.
Chst15-IN-1（Cat No.:I024637）is a selective small-molecule inhibitor of carbohydrate sulfotransferase 15 (CHST15), an enzyme involved in the sulfation of chondroitin sulfate E (CS-E), a glycosaminoglycan associated with tissue remodeling, fibrosis, and cancer progression. By blocking CHST15 activity, Chst15-IN-1 reduces CS-E biosynthesis, thereby modulating extracellular matrix composition and inhibiting pathological processes such as tumor invasion and fibrotic tissue accumulation. Preclinical studies have demonstrated its potential in treating fibrotic diseases and certain cancers. Chst15-IN-1 serves as a valuable research tool for exploring glycosaminoglycan biology and CHST15-related therapeutic pathways.
| CAS Number | 2158198-77-5 |
| Synonyms | (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide |
| Molecular Formula | C17H11BrCl2N2O3 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide |
| InChI | InChI=1S/C17H11BrCl2N2O3/c1-25-15-6-9(5-12(18)16(15)23)4-10(8-21)17(24)22-14-3-2-11(19)7-13(14)20/h2-7,23H,1H3,(H,22,24)/b10-4+ |
| InChIKey | RRFHFNDPXNWVTL-ONNFQVAWSA-N |
| SMILES | COC1=C(C(=CC(=C1)/C=C(\C#N)/C(=O)NC2=C(C=C(C=C2)Cl)Cl)Br)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
