For research use only. Not for therapeutic Use.
Chrysophanein（Cat No.:I018477）, also known as chrysophanol-8-O-β-D-glucoside, is a naturally occurring anthraquinone glycoside found in medicinal plants such as Rheum species. It exhibits diverse biological activities, including antioxidant, anti-inflammatory, hepatoprotective, antimicrobial, and anticancer properties. As a glycosylated anthraquinone, chrysophanein demonstrates improved solubility and stability compared to its aglycone form, chrysophanol. Research highlights its potential in modulating cellular signaling pathways, protecting against oxidative stress, and inhibiting tumor cell proliferation. Owing to these pharmacological effects, chrysophanein is regarded as a promising candidate for drug development and therapeutic applications.
| CAS Number | 4839-60-5 |
| Synonyms | 8-hydroxy-3-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
| Molecular Formula | C21H20O9 |
| Purity | ≥95% |
| IUPAC Name | 8-hydroxy-3-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
| InChI | InChI=1S/C21H20O9/c1-8-5-10-15(18(26)14-9(16(10)24)3-2-4-11(14)23)12(6-8)29-21-20(28)19(27)17(25)13(7-22)30-21/h2-6,13,17,19-23,25,27-28H,7H2,1H3/t13-,17-,19+,20-,21-/m1/s1 |
| InChIKey | QKPDYSSHOSPOKH-JNHRPPPUSA-N |
| SMILES | CC1=CC2=C(C(=C1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)C4=C(C2=O)C=CC=C4O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
