For research use only. Not for therapeutic Use.
Chromenone 1（Cat No.:I044072）is a bioactive small molecule based on the chromenone (coumarin) scaffold, known for its diverse pharmacological properties, including anti-inflammatory, antioxidant, anticancer, and antimicrobial effects. As a core chemical structure found in natural and synthetic compounds, Chromenone 1 is often used in medicinal chemistry research to explore structure-activity relationships (SARs) and develop novel therapeutic agents. It serves as a versatile lead compound in the design of inhibitors targeting enzymes such as kinases, oxidases, and proteases, making it valuable in drug discovery, cancer biology, and metabolic disease research.
| CAS Number | 1639929-29-5 |
| Synonyms | 2-(1,2,4-triazol-1-yl)-3-[4-(trifluoromethyl)phenyl]chromen-4-one |
| Molecular Formula | C18H10F3N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-3-[4-(trifluoromethyl)phenyl]chromen-4-one |
| InChI | InChI=1S/C18H10F3N3O2/c19-18(20,21)12-7-5-11(6-8-12)15-16(25)13-3-1-2-4-14(13)26-17(15)24-10-22-9-23-24/h1-10H |
| InChIKey | KLOOVUXILKCLLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(O2)N3C=NC=N3)C4=CC=C(C=C4)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
