For research use only. Not for therapeutic Use.
Choline-d₁₃ chloride（Cat No.:I045018）is a stable isotope-labeled form of choline chloride in which thirteen hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard in mass spectrometry and metabolic studies to trace and quantify endogenous choline and its derivatives with high accuracy. Choline plays a critical role in neurotransmitter synthesis, cell membrane integrity, and methyl group metabolism. The deuterated form ensures precise analytical differentiation without altering the biological activity of native choline. Choline-d₁₃ chloride is valuable in research focused on lipid metabolism, neurobiology, and nutritional biochemistry.
| CAS Number | 352438-97-2 |
| Synonyms | (1,1,2,2-tetradeuterio-2-hydroxyethyl)-tris(trideuteriomethyl)azanium;chloride |
| Molecular Formula | C5HD13ClNO |
| Purity | ≥95% |
| IUPAC Name | (1,1,2,2-tetradeuterio-2-hydroxyethyl)-tris(trideuteriomethyl)azanium;chloride |
| InChI | InChI=1S/C5H14NO.ClH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1/i1D3,2D3,3D3,4D2,5D2; |
| InChIKey | SGMZJAMFUVOLNK-TYBPHYHNSA-M |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])O.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
