For research use only. Not for therapeutic Use.
Choerospondin（Cat No.:I018352）is a bioactive natural compound originally isolated from Choerospondias axillaris, a medicinal plant used in traditional therapies. Belonging to the lignan and polyphenolic class of metabolites, choerospondin has attracted research interest for its antioxidant, anti-inflammatory, and potential anticancer activities. Studies suggest it may contribute to regulating oxidative stress, modulating immune pathways, and protecting against chronic disease progression. As a purified reference standard, choerospondin is valuable in natural product chemistry, pharmacology, and nutraceutical development, serving as a key compound for exploring plant-derived bioactives and their therapeutic potential in modern biomedical research.
| CAS Number | 81202-36-0 |
| Synonyms | (2S)-5,7-dihydroxy-2-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one |
| Molecular Formula | C21H22O10 |
| Purity | ≥95% |
| IUPAC Name | (2S)-5,7-dihydroxy-2-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-3-1-9(2-4-11)14-7-13(25)17-12(24)5-10(23)6-15(17)30-14/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16+,18+,19-,20+,21+/m0/s1 |
| InChIKey | KSDSYIXRWHRPMN-SFTVRKLSSA-N |
| SMILES | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
