Chloroquine phosphate is an antimalarial 4-aminoquinoline compound used to inhibit growth of malarial parasites and treat malarial infections.</br>Chloroquine enters a malarial parasite and binds to hemozoin, a non-toxic polymer formed from the parasite in an infected red blood cell. The chloroquine:hemozin complex interferes with normal membrane function leading to build-up of chloroquine:hemozin complexes and ultimately, cell lysis.
| Catalog Number | A000578 |
| CAS Number | 50-63-5 |
| Synonyms | NA |
| Molecular Formula | C₁₈H₂₆ClN₃·2H₃PO₄ |
| Purity | 95% |
| Target | Autophagy |
| Solubility | Limited solubility |
| Storage | Desiccate at RT |
| InChI | InChI=1S/C18H26ClN3.2H3O4P/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;2*1-5(2,3)4/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);2*(H3,1,2,3,4) |
| InChIKey | QKICWELGRMTQCR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OP(=O)(O)O.OP(=O)(O)O |
| Reference | Sullivan, David J. et. al. /On the Molecular Mechanism of Chloroquine/’s Antimalarial Action./ PNAS 93 (1996): 11865-1870. Nih.gov. Web. 2 Oct. 2013.</span></p> |
