Chlorophyllin sodium copper salt(Cat No.:I000415) is a semi-synthetic mixture that consists of water-soluble sodium copper salts derived from chlorophyll, the pigment responsible for the green color in plants. It is primarily utilized as a food additive to enhance the color and appearance of various food products. Additionally, it is also employed in alternative medicine due to its potential antioxidant and detoxification properties. Chlorophyllin sodium copper salt is available in supplement form and is claimed to provide health benefits such as aiding in digestion, supporting detoxification processes, and promoting wound healing.
Catalog Number | I000415 |
CAS Number | 11006-34-1 |
Molecular Formula | C34H31CuN4Na3O6 |
Purity | 95% |
Solubility | H2O:100mg/mL |
Storage | 2-8°C |
IUPAC Name | copper;trisodium;3-[20-(carboxylatomethyl)-18-(dioxidomethylidene)-8-ethenyl-13-ethyl-3,7,12,17-tetramethyl-2,3-dihydroporphyrin-23-id-2-yl]propanoate |
InChI | InChI=1S/C34H36N4O6.Cu.3Na/c1-7-19-15(3)23-12-25-17(5)21(9-10-29(39)40)32(37-25)22(11-30(41)42)33-31(34(43)44)18(6)26(38-33)14-28-20(8-2)16(4)24(36-28)13-27(19)35-23;;;;/h7,12-14,17,21H,1,8-11H2,2-6H3,(H5,35,36,37,38,39,40,41,42,43,44);;;;/q;+2;3*+1/p-5 |
InChIKey | HWDGVJUIHRPKFR-UHFFFAOYSA-I |
SMILES | CCC1=C(C2=CC3=NC(=CC4=NC(=C(C5=NC(=C(C5=C([O-])[O-])C)C=C1[N-]2)CC(=O)[O-])C(C4C)CCC(=O)[O-])C(=C3C=C)C)C.[Na+].[Na+].[Na+].[Cu+2] |
Reference | <p style=/line-height:25px/> |