For research use only. Not for therapeutic Use.
Chlorophyllide a(Cat No.:M061847)is a green, water-soluble pigment derived from the enzymatic removal of the phytol tail from chlorophyll a. It retains the chlorin ring structure with a central magnesium ion, allowing it to absorb light effectively in the blue and red regions of the spectrum. Chlorophyllide a plays a crucial role as an intermediate in chlorophyll biosynthesis and degradation. Due to its solubility and strong light-absorbing properties, it is studied in photobiology, photosynthesis research, and as a photosensitizer in biomedical applications. It is typically generated in plant tissues or through enzymatic extraction processes.
CAS Number | 14897-06-4 |
Molecular Formula | C35H34MgN4O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | magnesium;3-[(3R,21S,22S)-16-ethenyl-11-ethyl-3-methoxycarbonyl-12,17,21,26-tetramethyl-4-oxo-23,25-diaza-7,24-diazanidahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13(25),14,16,18,20(23)-decaen-22-yl]propanoic acid |
InChI | InChI=1S/C35H36N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8,12-14,17,21,31H,1,9-11H2,2-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/t17-,21-,31+;/m0./s1 |
InChIKey | ANWUQYTXRXCEMZ-NYABAGMLSA-L |
SMILES | CCC1=C(C2=NC1=CC3=C(C4=C([N-]3)C(=C5[C@H]([C@@H](C(=N5)C=C6C(=C(C(=C2)[N-]6)C=C)C)C)CCC(=O)O)[C@H](C4=O)C(=O)OC)C)C.[Mg+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |