Chlorophyll a is a vital green pigment found in plants, algae, and cyanobacteria, playing a crucial role in photosynthesis. Its molecular structure features a porphyrin ring with a central magnesium ion, allowing it to absorb light energy, primarily in the blue and red wavelengths. This absorbed energy drives the conversion of carbon dioxide and water into glucose and oxygen, supporting the growth of plants and serving as the foundation of the food chain. Chlorophyll a also contributes to the green color of vegetation and is studied for its potential health benefits, including antioxidant properties and applications in natural dyes and supplements.
| Catalog Number | R041779 |
| CAS Number | 479-61-8 |
| Synonyms | Phorbine Magnesium Deriv.; Chlorophyll a; Chlorophyll-1; Magnesium Pheophytin; Vegetable Chlorophyll; α-Chlorophyll; (SP-4-2)- [(2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl- |
| Molecular Formula | C₅₅H₇₂MgN₄O₅ |
| Purity | ≥95% |
| Storage | Store at +4 ℃ |
| InChI | 1S/C55H73N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13,26,28-33,37,41,51H,1,14-25,27H2,2-12H3,(H-,56,57,58,59,61);/q-1;+2/p-1/b34-26+;/t32-,33-,37+,41+,51-;/m1./s1 |
| InChIKey | ATNHDLDRLWWWCB-AENOIHSZSA-M |
| SMILES | CCC1=C(C2=NC1=CC3=C(C4=C([N-]3)C(=C5[C@H]([C@@H](C(=N5)C=C6C(=C(C(=C2)[N-]6)C=C)C)C)CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C4=O)C(=O)OC)C)C.[Mg+2] |
