For research use only. Not for therapeutic Use.
Chlormidazole hydrochloride（Cat No.:R063458）is an imidazole derivative supplied as the hydrochloride salt, improving its solubility and stability for laboratory use. It has been investigated for its antimicrobial and antifungal properties, reflecting the pharmacological versatility of imidazole-based compounds. In research, it serves as a reference compound to explore azole-class mechanisms, including inhibition of cytochrome P450–dependent enzymes involved in sterol biosynthesis. Its structural features make it useful in medicinal chemistry for developing new antifungal or antiparasitic agents. Chlormidazole hydrochloride remains a valuable tool in microbiology and drug discovery studies.
| CAS Number | 74298-63-8 |
| Synonyms | 1-[(4-chlorophenyl)methyl]-2-methylbenzimidazole;hydrochloride |
| Molecular Formula | C15H14Cl2N2 |
| Purity | ≥95% |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methylbenzimidazole;hydrochloride |
| InChI | InChI=1S/C15H13ClN2.ClH/c1-11-17-14-4-2-3-5-15(14)18(11)10-12-6-8-13(16)9-7-12;/h2-9H,10H2,1H3;1H |
| InChIKey | MHMTXDMLQZHXRZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2N1CC3=CC=C(C=C3)Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
