For research use only. Not for therapeutic Use.
Chiauranib（Cat No.:I044370）is an orally bioavailable small-molecule multi-kinase inhibitor designed to target key signaling pathways involved in tumor growth and angiogenesis. It selectively inhibits VEGFRs, PDGFRα, c-Kit, Aurora B kinase, and CSF-1R, thereby disrupting tumor vasculature, cell division, and the tumor microenvironment. Chiauranib has demonstrated potent anti-proliferative and anti-angiogenic effects in preclinical and clinical studies, particularly in solid tumors and hematologic malignancies. Its ability to simultaneously block angiogenesis and mitotic progression offers a dual mechanism of action, making it a promising candidate for the treatment of advanced and refractory cancers.
| CAS Number | 1256349-48-0 |
| Synonyms | N-(2-aminophenyl)-6-(7-methoxyquinolin-4-yl)oxynaphthalene-1-carboxamide |
| Molecular Formula | C27H21N3O3 |
| Purity | ≥95% |
| IUPAC Name | N-(2-aminophenyl)-6-(7-methoxyquinolin-4-yl)oxynaphthalene-1-carboxamide |
| InChI | InChI=1S/C27H21N3O3/c1-32-18-9-12-22-25(16-18)29-14-13-26(22)33-19-10-11-20-17(15-19)5-4-6-21(20)27(31)30-24-8-3-2-7-23(24)28/h2-16H,28H2,1H3,(H,30,31) |
| InChIKey | BRKWREZNORONDU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1)OC3=CC4=C(C=C3)C(=CC=C4)C(=O)NC5=CC=CC=C5N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
