For research use only. Not for therapeutic Use.
CGP-53353（Cat No.:M104290）is a potent and selective inhibitor of the enzyme PI3-kinase (phosphoinositide 3-kinase), specifically targeting the p110α isoform. PI3-kinase is involved in crucial cellular processes such as cell growth, survival, and metabolism, and its dysregulation is often associated with cancer and other diseases. By inhibiting PI3-kinase, CGP-53353 can disrupt signaling pathways that promote tumor growth, metastasis, and resistance to apoptosis. This compound shows promise in cancer research, particularly for treating tumors with overactive PI3-kinase signaling, and offers a potential strategy for targeted cancer therapies.
| CAS Number | 145915-60-2 |
| Synonyms | 5,6-bis(4-fluoroanilino)isoindole-1,3-dione |
| Molecular Formula | C20H13F2N3O2 |
| Purity | ≥95% |
| IUPAC Name | 5,6-bis(4-fluoroanilino)isoindole-1,3-dione |
| InChI | InChI=1S/C20H13F2N3O2/c21-11-1-5-13(6-2-11)23-17-9-15-16(20(27)25-19(15)26)10-18(17)24-14-7-3-12(22)4-8-14/h1-10,23-24H,(H,25,26,27) |
| InChIKey | RONQPWQYDRPRGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=C(C=C3C(=C2)C(=O)NC3=O)NC4=CC=C(C=C4)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
