For research use only. Not for therapeutic Use.
Cercosporin（Cat No.:R003101）is a perylenequinone toxin produced by Cercospora fungi, known as a key virulence factor in plant diseases. It acts as a photosensitizer, generating reactive oxygen species upon exposure to light, which damage cellular membranes, proteins, and DNA. This mechanism underlies its strong phytotoxicity and role in plant-pathogen interactions. Beyond agriculture, Cercosporin has been studied for its photodynamic properties, showing potential in antimicrobial and anticancer research. Its dual significance as both a plant toxin and a biomedical tool makes it valuable in natural product and photobiology studies.
| CAS Number | 35082-49-6 |
| Synonyms | 7,19-dihydroxy-5,21-bis(2-hydroxypropyl)-6,20-dimethoxy-12,14-dioxahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,15,18(23),19,21-nonaene-9,17-dione |
| Molecular Formula | C29H26O10 |
| Purity | ≥95% |
| IUPAC Name | 7,19-dihydroxy-5,21-bis(2-hydroxypropyl)-6,20-dimethoxy-12,14-dioxahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,15,18(23),19,21-nonaene-9,17-dione |
| InChI | InChI=1S/C29H26O10/c1-10(30)5-12-18-19-13(6-11(2)31)29(37-4)27(35)21-15(33)8-17-23(25(19)21)22-16(38-9-39-17)7-14(32)20(24(18)22)26(34)28(12)36-3/h7-8,10-11,30-31,34-35H,5-6,9H2,1-4H3 |
| InChIKey | MXLWQNCWIIZUQT-UHFFFAOYSA-N |
| SMILES | CC(CC1=C2C3=C(C(=C(C4=C3C5=C6C2=C(C(=O)C=C6OCOC5=CC4=O)C(=C1OC)O)O)OC)CC(C)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
