For research use only. Not for therapeutic Use.
| CAS Number | 31477-60-8 |
| Synonyms | rel-1-[2-[4-[(3R,4R)-3,4-dihydro-7-methoxy-2,2-dimethyl-3-phenyl-2H-1-benzopyran-4-yl]phenoxy]ethyl]pyrrolidine; 1-[2-[p-(trans-7-Methoxy-2,2-dimethyl-3-phenyl-4-chromanyl)phenoxy]ethyl]pyrrolidine; 3,4-trans-2,2-Dimethyl-3-phenyl-4-[p-(β-pyrrolidi |
| Molecular Formula | C30H35NO3 |
| Purity | ≥95% |
| Target | Estrogen/progestogen Receptor |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1-[2-[4-[(3S,4S)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]ethyl]pyrrolidine |
| InChI | InChI=1S/C30H35NO3/c1-30(2)29(23-9-5-4-6-10-23)28(26-16-15-25(32-3)21-27(26)34-30)22-11-13-24(14-12-22)33-20-19-31-17-7-8-18-31/h4-6,9-16,21,28-29H,7-8,17-20H2,1-3H3/t28-,29+/m0/s1 |
| InChIKey | XZEUAXYWNKYKPL-URLMMPGGSA-N |
| SMILES | CC1(C(C(C2=C(O1)C=C(C=C2)OC)C3=CC=C(C=C3)OCCN4CCCC4)C5=CC=CC=C5)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |