For research use only. Not for therapeutic Use.
Cearoin（Cat No.:I044812）is a naturally occurring pterocarpan, a subclass of isoflavonoids, primarily isolated from the heartwood of Dalbergia and Erythrina species. Known for its antimicrobial, antioxidant, and anti-inflammatory properties, cearoin plays a role in plant defense and has potential therapeutic value. Its structure features a fused tricyclic system with phenolic groups, enabling interactions with cellular targets. Emerging studies suggest that cearoin may inhibit key enzymes and modulate signaling pathways involved in inflammation and oxidative stress. This makes it a promising candidate for drug discovery in infectious and chronic inflammatory diseases.
| CAS Number | 52811-37-7 |
| Synonyms | (2,5-dihydroxy-4-methoxyphenyl)-phenylmethanone |
| Molecular Formula | C14H12O4 |
| Purity | ≥95% |
| IUPAC Name | (2,5-dihydroxy-4-methoxyphenyl)-phenylmethanone |
| InChI | InChI=1S/C14H12O4/c1-18-13-8-11(15)10(7-12(13)16)14(17)9-5-3-2-4-6-9/h2-8,15-16H,1H3 |
| InChIKey | NFJVELXCUBWAFL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)O)C(=O)C2=CC=CC=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
