For research use only. Not for therapeutic Use.
CDK9 inhibitor HH1（Cat No.:I041105）is a small molecule compound that targets cyclin-dependent kinase 9 (CDK9), an enzyme involved in regulating transcription elongation. By inhibiting CDK9, HH1 disrupts the transcriptional process, particularly in the context of genes that are overexpressed in cancer cells. This makes HH1 a promising candidate for cancer therapy, as it may help to block the expression of oncogenes and halt tumor growth. HH1 is under investigation for its potential to treat various cancers, including hematological malignancies, by targeting aberrant transcriptional regulation pathways.
| CAS Number | 204188-41-0 |
| Synonyms | [4-amino-2-(propan-2-ylamino)-1,3-thiazol-5-yl]-phenylmethanone |
| Molecular Formula | C13H15N3OS |
| Purity | ≥95% |
| IUPAC Name | [4-amino-2-(propan-2-ylamino)-1,3-thiazol-5-yl]-phenylmethanone |
| InChI | InChI=1S/C13H15N3OS/c1-8(2)15-13-16-12(14)11(18-13)10(17)9-6-4-3-5-7-9/h3-8H,14H2,1-2H3,(H,15,16) |
| InChIKey | WHJIFFVMTRXENN-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=NC(=C(S1)C(=O)C2=CC=CC=C2)N |
