For research use only. Not for therapeutic Use.
CDK9-IN-15(Cat No.:I043540)is a selective inhibitor of cyclin-dependent kinase 9 (CDK9), a key enzyme involved in regulating transcriptional elongation by phosphorylating RNA polymerase II. CDK9 plays a crucial role in the expression of genes associated with cell cycle progression, survival, and cancer cell proliferation. By inhibiting CDK9, CDK9-IN-15 can disrupt the transcription of oncogenes, thereby suppressing tumor growth. This compound has shown potential in preclinical studies as a therapeutic option for various cancers, including those that are resistant to conventional therapies, by targeting the underlying mechanisms of transcriptional regulation.
CAS Number | 852678-17-2 |
Synonyms | 5-(thieno[2,3-d]pyrimidin-4-ylamino)naphthalen-1-ol |
Molecular Formula | C16H11N3OS |
Purity | ≥95% |
IUPAC Name | 5-(thieno[2,3-d]pyrimidin-4-ylamino)naphthalen-1-ol |
InChI | InChI=1S/C16H11N3OS/c20-14-6-2-3-10-11(14)4-1-5-13(10)19-15-12-7-8-21-16(12)18-9-17-15/h1-9,20H,(H,17,18,19) |
InChIKey | WGOSYBWTPRPCIR-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC=C2O)C(=C1)NC3=C4C=CSC4=NC=N3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |