For research use only. Not for therapeutic Use.
CDK12-IN-5（Cat No.:I044417）is a potent and selective inhibitor of cyclin-dependent kinase 12 (CDK12), a key regulator of transcription elongation and DNA damage response through phosphorylation of RNA polymerase II. By blocking CDK12 activity, CDK12-IN-5 impairs the expression of genes involved in homologous recombination repair, including BRCA1 and ATR, leading to increased genomic instability and sensitization of cancer cells to DNA-damaging agents. This compound is valuable for investigating CDK12’s role in transcriptional regulation and DNA repair. It holds therapeutic potential in cancer types exhibiting reliance on intact DNA repair pathways.
| CAS Number | 2651200-35-8 |
| Synonyms | N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-morpholin-4-yl-8-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| Molecular Formula | C18H15F5N8O |
| Purity | ≥95% |
| IUPAC Name | N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-morpholin-4-yl-8-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| InChI | InChI=1S/C18H15F5N8O/c19-10-1-2-11-14(13(10)20)27-12(26-11)8-24-16-29-17(30-3-5-32-6-4-30)28-15-9(18(21,22)23)7-25-31(15)16/h1-2,7H,3-6,8H2,(H,26,27)(H,24,28,29) |
| InChIKey | XFZQHKMIWRKKCU-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC3=C(C=NN3C(=N2)NCC4=NC5=C(N4)C=CC(=C5F)F)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
