For research use only. Not for therapeutic Use.
CD73-IN-3（Cat No.:I031232）is a selective small-molecule inhibitor of CD73, an ecto-enzyme that converts AMP to adenosine, a potent immune suppressor. By blocking CD73, CD73-IN-3 prevents the accumulation of adenosine in the tumor microenvironment, thus enhancing anti-tumor immune responses. This inhibition can restore T-cell activity and reduce immune evasion mechanisms in cancers. CD73-IN-3 has demonstrated promising preclinical efficacy in solid tumors, particularly when combined with immune checkpoint inhibitors or other immunotherapies. It represents a novel therapeutic approach to overcome tumor-induced immune suppression and enhance the efficacy of cancer immunotherapies.
| CAS Number | 2375815-63-5 |
| Synonyms | 5-[6-methyl-5-[(1S,2R)-2-propan-2-ylcyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione |
| Molecular Formula | C15H18N4O2 |
| Purity | ≥95% |
| IUPAC Name | 5-[6-methyl-5-[(1S,2R)-2-propan-2-ylcyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C15H18N4O2/c1-7(2)9-4-11(9)10-5-13(19-18-8(10)3)12-6-16-15(21)17-14(12)20/h5-7,9,11H,4H2,1-3H3,(H2,16,17,20,21)/t9-,11+/m1/s1 |
| InChIKey | WHRUIISQCORGKK-KOLCDFICSA-N |
| SMILES | CC1=NN=C(C=C1[C@H]2C[C@@H]2C(C)C)C3=CNC(=O)NC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
