For research use only. Not for therapeutic Use.
CCT374705(CAT: I040931) is an orally active inhibitor of BCL6, a transcriptional repressor that plays a critical role in the development and survival of various cancers, particularly lymphomas. By inhibiting BCL6, CCT374705 disrupts the transcriptional regulation of key genes involved in cell proliferation, survival, and immune evasion. In vitro studies have shown potent antiproliferative effects, and CCT374705 has demonstrated the ability to effectively inhibit tumor growth in a lymphoma xenograft mouse model. This compound is highly relevant for Cancer Disease Research, particularly in the development of targeted therapies for lymphoma and other cancers associated with BCL6 dysregulation.
| CAS Number | 2640647-90-9 |
| Synonyms | (2S)-10-[(3-chloro-2-fluoropyridin-4-yl)amino]-2-cyclopropyl-3,3-difluoro-7-methyl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one |
| Molecular Formula | C21H18ClF3N4O2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-10-[(3-chloro-2-fluoropyridin-4-yl)amino]-2-cyclopropyl-3,3-difluoro-7-methyl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one |
| InChI | InChI=1S/C21H18ClF3N4O2/c1-29-14-5-4-11(27-13-6-7-26-19(23)15(13)22)8-12(14)16-17(20(29)30)31-9-21(24,25)18(28-16)10-2-3-10/h4-8,10,18,28H,2-3,9H2,1H3,(H,26,27)/t18-/m0/s1 |
| InChIKey | MCRHRRIGPAVFNY-SFHVURJKSA-N |
| SMILES | CN1C2=C(C=C(C=C2)NC3=C(C(=NC=C3)F)Cl)C4=C(C1=O)OCC(C(N4)C5CC5)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |