For research use only. Not for therapeutic Use.
CCG258747（Cat No.:I044168）is a small-molecule inhibitor that selectively targets the Rho/MRTF/SRF transcriptional signaling pathway, implicated in cancer cell migration and metastasis. It functions by disrupting MRTF-A nuclear localization and SRF-mediated gene expression, which are essential for cytoskeletal dynamics and tumor progression. CCG258747 has demonstrated potent anti-migratory effects in cancer models, particularly in triple-negative breast cancer (TNBC) and melanoma. Its utility extends to probing Rho GTPase signaling and evaluating anti-metastatic strategies. CCG258747 is a valuable research tool in cancer biology and signal transduction investigations.
| CAS Number | 2615910-00-2 |
| Synonyms | 5-[(3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)piperidin-4-yl]-2-fluoro-N-(2H-indazol-3-ylmethyl)benzamide |
| Molecular Formula | C28H27FN4O4 |
| Purity | ≥95% |
| IUPAC Name | 5-[(3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)piperidin-4-yl]-2-fluoro-N-(2H-indazol-3-ylmethyl)benzamide |
| InChI | InChI=1S/C28H27FN4O4/c29-23-7-5-17(11-22(23)28(34)31-14-25-21-3-1-2-4-24(21)32-33-25)20-9-10-30-13-18(20)15-35-19-6-8-26-27(12-19)37-16-36-26/h1-8,11-12,18,20,30H,9-10,13-16H2,(H,31,34)(H,32,33)/t18-,20-/m0/s1 |
| InChIKey | KGSBEYKVWODBRD-ICSRJNTNSA-N |
| SMILES | C1CNC[C@H]([C@@H]1C2=CC(=C(C=C2)F)C(=O)NCC3=C4C=CC=CC4=NN3)COC5=CC6=C(C=C5)OCO6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
