For research use only. Not for therapeutic Use.
CB65（Cat No.:R036554）is a selective and potent dual inhibitor of p38 mitogen-activated protein kinase (MAPK) and glycogen synthase kinase-3 (GSK-3), two key enzymes involved in regulating inflammation, apoptosis, and cellular stress responses. By inhibiting both kinases, CB65 modulates pro-inflammatory cytokine production and cell survival pathways, making it a valuable compound in research on neurodegenerative diseases, cancer, and inflammatory disorders. CB65 is widely used to dissect the cross-talk between MAPK and GSK-3 signaling cascades and to evaluate the therapeutic potential of dual-targeted kinase inhibition in complex pathological conditions.
| CAS Number | 913534-05-1 |
| Synonyms | 7-chloro-N-cyclohexyl-1-(2-morpholin-4-ylethyl)-4-oxoquinoline-3-carboxamide |
| Molecular Formula | C22H28ClN3O3 |
| Purity | ≥95% |
| IUPAC Name | 7-chloro-N-cyclohexyl-1-(2-morpholin-4-ylethyl)-4-oxoquinoline-3-carboxamide |
| InChI | InChI=1S/C22H28ClN3O3/c23-16-6-7-18-20(14-16)26(9-8-25-10-12-29-13-11-25)15-19(21(18)27)22(28)24-17-4-2-1-3-5-17/h6-7,14-15,17H,1-5,8-13H2,(H,24,28) |
| InChIKey | MFKWLGOHFQBVAA-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CN(C3=C(C2=O)C=CC(=C3)Cl)CCN4CCOCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
