For research use only. Not for therapeutic Use.
CAY10590（Cat No.:R064359）is an experimental small molecule compound being investigated for its potential in treating various diseases, particularly inflammatory and autoimmune conditions. It functions as a selective inhibitor of specific kinases involved in the regulation of immune responses, cell proliferation, and inflammation. By targeting these pathways, CAY10590 aims to modulate immune cell activity, reduce inflammation, and prevent excessive immune responses associated with chronic conditions. Preclinical studies have shown promise, and ongoing research is focused on evaluating its safety, efficacy, and therapeutic potential in treating conditions such as rheumatoid arthritis and other inflammatory diseases.
| CAS Number | 1101136-50-8 |
| Synonyms | (4R)-4-(7-phenylheptanoylamino)octanoic acid |
| Molecular Formula | C21H33NO3 |
| Purity | ≥95% |
| IUPAC Name | (4R)-4-(7-phenylheptanoylamino)octanoic acid |
| InChI | InChI=1S/C21H33NO3/c1-2-3-14-19(16-17-21(24)25)22-20(23)15-10-5-4-7-11-18-12-8-6-9-13-18/h6,8-9,12-13,19H,2-5,7,10-11,14-17H2,1H3,(H,22,23)(H,24,25)/t19-/m1/s1 |
| InChIKey | ANTPELWBOPVWPH-LJQANCHMSA-N |
| SMILES | CCCC[C@H](CCC(=O)O)NC(=O)CCCCCCC1=CC=CC=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
