For research use only. Not for therapeutic Use.
CAY10526（Cat No.:R031574）is a selective inhibitor of the enzyme Stearoyl-CoA desaturase-1 (SCD1), pivotal in lipid metabolism and fatty acid synthesis. By targeting SCD1, CAY10526 effectively reduces lipid accumulation and modulates cellular lipid profiles, making it valuable in research areas including obesity, diabetes, and metabolic disorders. Additionally, CAY10526 shows potential in cancer research by affecting lipid-driven tumor cell growth. Its targeted inhibition of SCD1 provides a critical tool for exploring lipid-associated metabolic pathways, cellular signaling, and therapeutic strategies for conditions characterized by dysregulated lipid metabolism and metabolic syndrome.
| CAS Number | 938069-71-7 |
| Synonyms | 3-(1-benzothiophen-2-yl)-4-bromo-2-hydroxy-2H-furan-5-one |
| Molecular Formula | C12H7BrO3S |
| Purity | ≥95% |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-4-bromo-2-hydroxy-2H-furan-5-one |
| InChI | InChI=1S/C12H7BrO3S/c13-10-9(11(14)16-12(10)15)8-5-6-3-1-2-4-7(6)17-8/h1-5,11,14H |
| InChIKey | ICCDILPNCJIDAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=C(C(=O)OC3O)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
