For research use only. Not for therapeutic Use.
Cavosonstat (Cat No.:I005689) is a selective inhibitor of S-nitrosoglutathione reductase (GSNOR), an enzyme involved in regulating nitric oxide (NO) signaling through the degradation of S-nitrosoglutathione (GSNO). By inhibiting GSNOR, Cavosonstat increases intracellular GSNO levels, enhancing S-nitrosylation of target proteins and promoting NO-mediated processes. It has been investigated for therapeutic use in cystic fibrosis to improve CFTR protein function and reduce oxidative stress. Cavosonstat is a valuable research tool for studying redox biology, NO signaling pathways, and potential treatments for respiratory and inflammatory diseases.
| CAS Number | 1371587-51-7 |
| Synonyms | 3-chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid |
| Molecular Formula | C16H10ClNO3 |
| Purity | ≥95% |
| IUPAC Name | 3-chloro-4-(6-hydroxyquinolin-2-yl)benzoic acid |
| InChI | InChI=1S/C16H10ClNO3/c17-13-8-10(16(20)21)1-4-12(13)15-5-2-9-7-11(19)3-6-14(9)18-15/h1-8,19H,(H,20,21) |
| InChIKey | BXSZILNGNMDGSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)C2=NC3=C(C=C2)C=C(C=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |