For research use only. Not for therapeutic Use.
CaV1.3 antagonist-1（Cast No.:I025169）is a selective small-molecule inhibitor targeting the CaV1.3 subtype of L-type voltage-gated calcium channels. By blocking calcium influx through these channels, it modulates neuronal excitability, hormone secretion, and pacemaker activity in the heart. This compound is valuable for research into neurological disorders such as Parkinson’s disease, epilepsy, and depression, as well as cardiovascular conditions like arrhythmias. Its subtype selectivity allows for precise dissection of CaV1.3-mediated physiological and pathological processes, making it a promising tool in drug discovery and mechanistic studies focused on calcium channel regulation and therapeutic intervention.
| CAS Number | 1391385-57-1 |
| Synonyms | 1-[2-(3-chlorophenyl)ethyl]-3-cyclopentyl-1,3-diazinane-2,4,6-trione |
| Molecular Formula | C17H19ClN2O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-cyclopentyl-1,3-diazinane-2,4,6-trione |
| InChI | InChI=1S/C17H19ClN2O3/c18-13-5-3-4-12(10-13)8-9-19-15(21)11-16(22)20(17(19)23)14-6-1-2-7-14/h3-5,10,14H,1-2,6-9,11H2 |
| InChIKey | AJKSBVCOTKODMF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C(=O)CC(=O)N(C2=O)CCC3=CC(=CC=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
