For research use only. Not for therapeutic Use.
Cassiaside（Cat No.:I044860）is a phenolic glycoside isolated from Cassia species, particularly Cassia tora and Cassia obtusifolia, plants widely used in traditional medicine. Structurally, it features an anthraquinone or naphthopyrone core linked to a sugar moiety, contributing to its solubility and biological activity. Cassiaside exhibits strong antioxidant, hepatoprotective, and anti-inflammatory effects, and has shown promise in protecting against oxidative liver injury and metabolic disorders. It also possesses mild laxative properties. Due to these benefits, Cassiaside is considered a valuable phytochemical for use in herbal remedies and functional food development.
| CAS Number | 13709-03-0 |
| Synonyms | 4,5-dihydroxy-2-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[g]chromen-8-one |
| Molecular Formula | C20H20O10 |
| Purity | ≥95% |
| IUPAC Name | 5-hydroxy-2-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[g]chromen-4-one |
| InChI | InChI=1S/C20H20O9/c1-8-5-10(22)15-12(27-8)6-9-3-2-4-11(14(9)17(15)24)28-20-19(26)18(25)16(23)13(7-21)29-20/h2-6,13,16,18-21,23-26H,7H2,1H3/t13-,16-,18+,19-,20-/m1/s1 |
| InChIKey | SBVZTBIAKFTNIJ-CZNQJBLBSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C=C3C=CC=C(C3=C2O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
