For research use only. Not for therapeutic Use.
Casein Kinase Inhibitor A86（Cat No.:I044381）is a potent and selective inhibitor targeting Casein Kinase 1 (CK1) isoforms, particularly CK1δ and CK1ε. This small molecule disrupts key signaling pathways, including Wnt/β-catenin and circadian rhythm regulation, making it a valuable research tool in cancer biology and neurodegenerative disease studies. A86 exhibits high affinity and cell permeability, offering consistent in vitro and in vivo performance. It aids in unraveling CK1’s role in tumor progression, cell cycle control, and chronobiology, facilitating the development of targeted therapies in oncology and neurological research.
| CAS Number | 2079069-01-3 |
| Synonyms | 4-N-[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]cyclohexane-1,4-diamine |
| Molecular Formula | C18H25FN6 |
| Purity | ≥95% |
| IUPAC Name | 4-N-[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]cyclohexane-1,4-diamine |
| InChI | InChI=1S/C18H25FN6/c1-25-16(8-11-2-3-11)14(9-22-25)17-15(19)10-21-18(24-17)23-13-6-4-12(20)5-7-13/h9-13H,2-8,20H2,1H3,(H,21,23,24) |
| InChIKey | YSPIHUWHLMNFOV-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=NC(=NC=C2F)NC3CCC(CC3)N)CC4CC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
