For research use only. Not for therapeutic Use.
Carubicin hydrochloride（Cat No.:I005664）is an anthracycline antibiotic and chemotherapeutic agent structurally related to doxorubicin. It intercalates into DNA and inhibits topoisomerase II, leading to DNA strand breaks and the inhibition of nucleic acid synthesis. Carubicin is primarily used in the treatment of bladder cancer, often administered intravesically to target tumor cells while minimizing systemic toxicity. Its enhanced stability and reduced cardiotoxicity compared to other anthracyclines make it a valuable alternative in oncology. Carubicin hydrochloride is also studied for its antitumor activity across various solid tumors and hematologic malignancies.
| CAS Number | 52794-97-5 |
| Synonyms | (7S,9S)-9-acetyl-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,6,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| Molecular Formula | C26H28ClNO10 |
| Purity | ≥95% |
| IUPAC Name | (7S,9S)-9-acetyl-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,6,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| InChI | InChI=1S/C26H27NO10.ClH/c1-9-21(30)13(27)6-16(36-9)37-15-8-26(35,10(2)28)7-12-18(15)25(34)20-19(23(12)32)22(31)11-4-3-5-14(29)17(11)24(20)33;/h3-5,9,13,15-16,21,29-30,32,34-35H,6-8,27H2,1-2H3;1H/t9-,13-,15-,16-,21+,26-;/m0./s1 |
| InChIKey | WYVYEIZFAUXWKW-SHUUXQFMSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)O)O)(C(=O)C)O)N)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
