For research use only. Not for therapeutic Use.
Carnosic Acid(Cat No.:R022307)is a high-purity, naturally occurring polyphenolic diterpene found in rosemary and sage. It is renowned for its potent antioxidant and anti-inflammatory properties, making it valuable in food preservation, cosmetics, and health supplements. Carnosic Acid protects cells from oxidative stress and is used to extend the shelf life of food products by preventing rancidity. In pharmaceutical research, it is studied for its potential neuroprotective and anticancer effects. Its versatility and efficacy make it essential for advancing health and wellness applications, promoting longevity, and enhancing product stability.
| CAS Number | 3650-09-7 |
| Synonyms | (4aR-trans)-1,3,4,9,10,10a-Hexahydro-5,6-dihydroxy-1,1-dimethyl-7-(1-methylethyl)4a(2H)-Phenanthrenecarboxylic Acid; 11,12-Dihydroxy-13-isopropyl-podocarpa-8,11,13-trien-17-oic Acid; Rosamox; RoseOx; Salvin; |
| Molecular Formula | C20H28O4 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
| InChI | InChI=1S/C20H28O4/c1-11(2)13-10-12-6-7-14-19(3,4)8-5-9-20(14,18(23)24)15(12)17(22)16(13)21/h10-11,14,21-22H,5-9H2,1-4H3,(H,23,24)/t14-,20+/m0/s1 |
| InChIKey | QRYRORQUOLYVBU-VBKZILBWSA-N |
| SMILES | CC(C)C1=C(C(=C2C(=C1)CCC3C2(CCCC3(C)C)C(=O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |