For research use only. Not for therapeutic Use.
Carbohydrazide(CAT: R070257) is a versatile hydrazine derivative widely employed in industrial chemistry as an efficient oxygen scavenger for boiler water treatment and corrosion inhibition. Known for its exceptional reactivity and reducing properties, it effectively removes dissolved oxygen, preventing corrosion and scaling in steam generation systems. Additionally, carbohydrazide functions as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and polymers, offering precise control and improved yields in chemical transformations. Its non-toxic and environmentally friendly profile makes carbohydrazide an attractive alternative to traditional chemical agents, enabling safer handling and broader applicability across diverse industries, from water treatment processes to advanced synthetic chemistry.
| CAS Number | 497-18-7 |
| Synonyms | Carbonic dihydrazide, 1,3-Diaminourea, Carbodihydrazide |
| Molecular Formula | CH6N4O |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1,3-diaminourea |
| InChI | InChI=1S/CH6N4O/c2-4-1(6)5-3/h2-3H2,(H2,4,5,6) |
| InChIKey | XEVRDFDBXJMZFG-UHFFFAOYSA-N |
| SMILES | C(=O)(NN)NN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |